C26H25ClFN3O2 — CID 83284079
3-(6-chloro-3-pyridinyl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 83284079) has the molecular formula C26H25ClFN3O2 and a molecular weight of 465.96 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-(6-chloro-3-pyridinyl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 83284079 |
| Molecular Formula | C26H25ClFN3O2 |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CC(c1ccc(Cl)nc1)c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C26H25ClFN3O2/c1-33-13-12-29-26(32)14-22(19-8-11-25(27)30-15-19)23-17-31(24-5-3-2-4-21(23)24)16-18-6-9-20(28)10-7-18/h2-11,15,17,22H,12-14,16H2,1H3,(H,29,32) |
| InChIKey | RKTAKSJLELFCTM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|