C28H28ClFN2O2 — CID 92961932
(3S)-3-(3-chlorophenyl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(3-methoxypropyl)propanamide (PubChem CID 92961932) has the molecular formula C28H28ClFN2O2 and a molecular weight of 479.00 g/mol. Its IUPAC name is (3S)-3-(3-chlorophenyl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(3-methoxypropyl)propanamide.
| Compound Name | (3S)-3-(3-chlorophenyl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 92961932 |
| Molecular Formula | C28H28ClFN2O2 |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (3S)-3-(3-chlorophenyl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C[C@@H](c1cccc(Cl)c1)c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C28H28ClFN2O2/c1-34-15-5-14-31-28(33)17-25(21-6-4-7-22(29)16-21)26-19-32(27-9-3-2-8-24(26)27)18-20-10-12-23(30)13-11-20/h2-4,6-13,16,19,25H,5,14-15,17-18H2,1H3,(H,31,33)/t25-/m0/s1 |
| InChIKey | BIXQCLNPYQPWAD-VWLOTQADSA-N |
| XLogP | 6.16 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|