C29H31FN2O2 — CID 4252671
3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(3-methoxypropyl)-3-(3-methylphenyl)propanamide (PubChem CID 4252671) has the molecular formula C29H31FN2O2 and a molecular weight of 458.58 g/mol. Its IUPAC name is 3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(3-methoxypropyl)-3-(3-methylphenyl)propanamide.
| Compound Name | 3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(3-methoxypropyl)-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 4252671 |
| Molecular Formula | C29H31FN2O2 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(3-methoxypropyl)-3-(3-methylphenyl)propanamide |
| SMILES | COCCCNC(=O)CC(c1cccc(C)c1)c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C29H31FN2O2/c1-21-7-5-8-23(17-21)26(18-29(33)31-15-6-16-34-2)27-20-32(28-10-4-3-9-25(27)28)19-22-11-13-24(30)14-12-22/h3-5,7-14,17,20,26H,6,15-16,18-19H2,1-2H3,(H,31,33) |
| InChIKey | WEAHYRFHQRWIKH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|