C32H29FN2O — CID 92952967
(3S)-N-benzyl-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(3-methylphenyl)propanamide (PubChem CID 92952967) has the molecular formula C32H29FN2O and a molecular weight of 476.60 g/mol. Its IUPAC name is (3S)-N-benzyl-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(3-methylphenyl)propanamide.
| Compound Name | (3S)-N-benzyl-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 92952967 |
| Molecular Formula | C32H29FN2O |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (3S)-N-benzyl-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc([C@H](CC(=O)NCc2ccccc2)c2cn(Cc3ccc(F)cc3)c3ccccc23)c1 |
| InChI | InChI=1S/C32H29FN2O/c1-23-8-7-11-26(18-23)29(19-32(36)34-20-24-9-3-2-4-10-24)30-22-35(31-13-6-5-12-28(30)31)21-25-14-16-27(33)17-15-25/h2-18,22,29H,19-21H2,1H3,(H,34,36)/t29-/m0/s1 |
| InChIKey | KFCDNUFIISLFAD-LJAQVGFWSA-N |
| XLogP | 6.98 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |