C28H29FN2O — CID 93012495
(3S)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(3-methylphenyl)-N-propan-2-ylpropanamide (PubChem CID 93012495) has the molecular formula C28H29FN2O and a molecular weight of 428.55 g/mol. Its IUPAC name is (3S)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(3-methylphenyl)-N-propan-2-ylpropanamide.
| Compound Name | (3S)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(3-methylphenyl)-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 93012495 |
| Molecular Formula | C28H29FN2O |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | (3S)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(3-methylphenyl)-N-propan-2-ylpropanamide |
| SMILES | Cc1cccc([C@H](CC(=O)NC(C)C)c2cn(Cc3ccc(F)cc3)c3ccccc23)c1 |
| InChI | InChI=1S/C28H29FN2O/c1-19(2)30-28(32)16-25(22-8-6-7-20(3)15-22)26-18-31(27-10-5-4-9-24(26)27)17-21-11-13-23(29)14-12-21/h4-15,18-19,25H,16-17H2,1-3H3,(H,30,32)/t25-/m0/s1 |
| InChIKey | MUHWGNYOFSGVKO-VWLOTQADSA-N |
| XLogP | 6.18 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |