C29H31FN2O — CID 3576257
3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(3-methylphenyl)-N-(2-methylpropyl)propanamide (PubChem CID 3576257) has the molecular formula C29H31FN2O and a molecular weight of 442.58 g/mol. Its IUPAC name is 3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(3-methylphenyl)-N-(2-methylpropyl)propanamide.
| Compound Name | 3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(3-methylphenyl)-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 3576257 |
| Molecular Formula | C29H31FN2O |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(3-methylphenyl)-N-(2-methylpropyl)propanamide |
| SMILES | Cc1cccc(C(CC(=O)NCC(C)C)c2cn(Cc3ccc(F)cc3)c3ccccc23)c1 |
| InChI | InChI=1S/C29H31FN2O/c1-20(2)17-31-29(33)16-26(23-8-6-7-21(3)15-23)27-19-32(28-10-5-4-9-25(27)28)18-22-11-13-24(30)14-12-22/h4-15,19-20,26H,16-18H2,1-3H3,(H,31,33) |
| InChIKey | HWQZAJSLAUDDAE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |