C23H28N2O — CID 42774737
3-(1-methylindol-3-yl)-3-(3-methylphenyl)-N-(2-methylpropyl)propanamide (PubChem CID 42774737) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-3-(3-methylphenyl)-N-(2-methylpropyl)propanamide.
| Compound Name | 3-(1-methylindol-3-yl)-3-(3-methylphenyl)-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 42774737 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 3-(1-methylindol-3-yl)-3-(3-methylphenyl)-N-(2-methylpropyl)propanamide |
| SMILES | Cc1cccc(C(CC(=O)NCC(C)C)c2cn(C)c3ccccc23)c1 |
| InChI | InChI=1S/C23H28N2O/c1-16(2)14-24-23(26)13-20(18-9-7-8-17(3)12-18)21-15-25(4)22-11-6-5-10-19(21)22/h5-12,15-16,20H,13-14H2,1-4H3,(H,24,26) |
| InChIKey | BFPUIDGFBGYQJZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |