C24H30N2O — CID 3336287
N-(3-methylbutyl)-3-(1-methylindol-3-yl)-3-(3-methylphenyl)propanamide (PubChem CID 3336287) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is N-(3-methylbutyl)-3-(1-methylindol-3-yl)-3-(3-methylphenyl)propanamide.
| Compound Name | N-(3-methylbutyl)-3-(1-methylindol-3-yl)-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 3336287 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | N-(3-methylbutyl)-3-(1-methylindol-3-yl)-3-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(C(CC(=O)NCCC(C)C)c2cn(C)c3ccccc23)c1 |
| InChI | InChI=1S/C24H30N2O/c1-17(2)12-13-25-24(27)15-21(19-9-7-8-18(3)14-19)22-16-26(4)23-11-6-5-10-20(22)23/h5-11,14,16-17,21H,12-13,15H2,1-4H3,(H,25,27) |
| InChIKey | SOXOXBOQWOCVIQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |