C27H25F3N2O — CID 93122545
(3R)-3-(1-methylindol-3-yl)-N-(2-phenylethyl)-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 93122545) has the molecular formula C27H25F3N2O and a molecular weight of 450.50 g/mol. Its IUPAC name is (3R)-3-(1-methylindol-3-yl)-N-(2-phenylethyl)-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (3R)-3-(1-methylindol-3-yl)-N-(2-phenylethyl)-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 93122545 |
| Molecular Formula | C27H25F3N2O |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (3R)-3-(1-methylindol-3-yl)-N-(2-phenylethyl)-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cn1cc([C@H](CC(=O)NCCc2ccccc2)c2cccc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C27H25F3N2O/c1-32-18-24(22-12-5-6-13-25(22)32)23(20-10-7-11-21(16-20)27(28,29)30)17-26(33)31-15-14-19-8-3-2-4-9-19/h2-13,16,18,23H,14-15,17H2,1H3,(H,31,33)/t23-/m1/s1 |
| InChIKey | ONYZKFGDESBKKR-HSZRJFAPSA-N |
| XLogP | 6.08 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |