C27H24F4N2O — CID 42801362
3-(1-ethylindol-3-yl)-3-(3-fluorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 42801362) has the molecular formula C27H24F4N2O and a molecular weight of 468.49 g/mol. Its IUPAC name is 3-(1-ethylindol-3-yl)-3-(3-fluorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 3-(1-ethylindol-3-yl)-3-(3-fluorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 42801362 |
| Molecular Formula | C27H24F4N2O |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3-(1-ethylindol-3-yl)-3-(3-fluorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | CCn1cc(C(CC(=O)NCc2cccc(C(F)(F)F)c2)c2cccc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C27H24F4N2O/c1-2-33-17-24(22-11-3-4-12-25(22)33)23(19-8-6-10-21(28)14-19)15-26(34)32-16-18-7-5-9-20(13-18)27(29,30)31/h3-14,17,23H,2,15-16H2,1H3,(H,32,34) |
| InChIKey | KBDJLKGCGDDOKR-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |