C25H29F3N2O — CID 93122569
(3R)-N-hexyl-3-(1-methylindol-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 93122569) has the molecular formula C25H29F3N2O and a molecular weight of 430.51 g/mol. Its IUPAC name is (3R)-N-hexyl-3-(1-methylindol-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (3R)-N-hexyl-3-(1-methylindol-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 93122569 |
| Molecular Formula | C25H29F3N2O |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (3R)-N-hexyl-3-(1-methylindol-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCCCCCNC(=O)C[C@H](c1cccc(C(F)(F)F)c1)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C25H29F3N2O/c1-3-4-5-8-14-29-24(31)16-21(18-10-9-11-19(15-18)25(26,27)28)22-17-30(2)23-13-7-6-12-20(22)23/h6-7,9-13,15,17,21H,3-5,8,14,16H2,1-2H3,(H,29,31)/t21-/m1/s1 |
| InChIKey | AJNLFJCNYVWLGE-OAQYLSRUSA-N |
| XLogP | 6.42 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|