C24H28F3N3O — CID 5050639
N-hexyl-3-(8-methylimidazo[1,2-a]pyridin-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 5050639) has the molecular formula C24H28F3N3O and a molecular weight of 431.50 g/mol. Its IUPAC name is N-hexyl-3-(8-methylimidazo[1,2-a]pyridin-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-hexyl-3-(8-methylimidazo[1,2-a]pyridin-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 5050639 |
| Molecular Formula | C24H28F3N3O |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-hexyl-3-(8-methylimidazo[1,2-a]pyridin-3-yl)-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCCCCCNC(=O)CC(c1cccc(C(F)(F)F)c1)c1cnc2c(C)cccn12 |
| InChI | InChI=1S/C24H28F3N3O/c1-3-4-5-6-12-28-22(31)15-20(18-10-7-11-19(14-18)24(25,26)27)21-16-29-23-17(2)9-8-13-30(21)23/h7-11,13-14,16,20H,3-6,12,15H2,1-2H3,(H,28,31) |
| InChIKey | UYZHRKLCJMGYGQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|