C27H28FN3O2 — CID 4524635
N-butyl-3-(3-fluorophenyl)-3-(8-phenylmethoxyimidazo[1,2-a]pyridin-3-yl)propanamide (PubChem CID 4524635) has the molecular formula C27H28FN3O2 and a molecular weight of 445.54 g/mol. Its IUPAC name is N-butyl-3-(3-fluorophenyl)-3-(8-phenylmethoxyimidazo[1,2-a]pyridin-3-yl)propanamide.
| Compound Name | N-butyl-3-(3-fluorophenyl)-3-(8-phenylmethoxyimidazo[1,2-a]pyridin-3-yl)propanamide |
|---|---|
| PubChem CID | 4524635 |
| Molecular Formula | C27H28FN3O2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | N-butyl-3-(3-fluorophenyl)-3-(8-phenylmethoxyimidazo[1,2-a]pyridin-3-yl)propanamide |
| SMILES | CCCCNC(=O)CC(c1cccc(F)c1)c1cnc2c(OCc3ccccc3)cccn12 |
| InChI | InChI=1S/C27H28FN3O2/c1-2-3-14-29-26(32)17-23(21-11-7-12-22(28)16-21)24-18-30-27-25(13-8-15-31(24)27)33-19-20-9-5-4-6-10-20/h4-13,15-16,18,23H,2-3,14,17,19H2,1H3,(H,29,32) |
| InChIKey | YQWVVUSUACHCLX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|