C24H30N2O3 — CID 3602698
N-butyl-3-(3,5-dimethoxyphenyl)-3-(1-methylindol-3-yl)propanamide (PubChem CID 3602698) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-butyl-3-(3,5-dimethoxyphenyl)-3-(1-methylindol-3-yl)propanamide.
| Compound Name | N-butyl-3-(3,5-dimethoxyphenyl)-3-(1-methylindol-3-yl)propanamide |
|---|---|
| PubChem CID | 3602698 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-butyl-3-(3,5-dimethoxyphenyl)-3-(1-methylindol-3-yl)propanamide |
| SMILES | CCCCNC(=O)CC(c1cc(OC)cc(OC)c1)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C24H30N2O3/c1-5-6-11-25-24(27)15-21(17-12-18(28-3)14-19(13-17)29-4)22-16-26(2)23-10-8-7-9-20(22)23/h7-10,12-14,16,21H,5-6,11,15H2,1-4H3,(H,25,27) |
| InChIKey | FUQSRKNJUXTBIG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|