C25H24FN3O — CID 42801286
3-(1-ethylindol-3-yl)-3-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 42801286) has the molecular formula C25H24FN3O and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-(1-ethylindol-3-yl)-3-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-(1-ethylindol-3-yl)-3-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 42801286 |
| Molecular Formula | C25H24FN3O |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-(1-ethylindol-3-yl)-3-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | CCn1cc(C(CC(=O)NCc2cccnc2)c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H24FN3O/c1-2-29-17-23(21-7-3-4-8-24(21)29)22(19-9-11-20(26)12-10-19)14-25(30)28-16-18-6-5-13-27-15-18/h3-13,15,17,22H,2,14,16H2,1H3,(H,28,30) |
| InChIKey | GLMOQIDICGHDIX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |