C30H25FN4O3 — CID 42801418
3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 42801418) has the molecular formula C30H25FN4O3 and a molecular weight of 508.55 g/mol. Its IUPAC name is 3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 42801418 |
| Molecular Formula | C30H25FN4O3 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | O=C(CC(c1ccc(F)cc1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12)NCc1cccnc1 |
| InChI | InChI=1S/C30H25FN4O3/c31-24-10-8-23(9-11-24)26(16-30(36)33-18-22-7-4-14-32-17-22)28-20-34(19-21-5-2-1-3-6-21)29-13-12-25(35(37)38)15-27(28)29/h1-15,17,20,26H,16,18-19H2,(H,33,36) |
| InChIKey | GFZONSMFQCMKBH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|