C32H29N3O3 — CID 93120140
(3R)-3-(1-benzyl-5-nitroindol-3-yl)-3-phenyl-N-(2-phenylethyl)propanamide (PubChem CID 93120140) has the molecular formula C32H29N3O3 and a molecular weight of 503.60 g/mol. Its IUPAC name is (3R)-3-(1-benzyl-5-nitroindol-3-yl)-3-phenyl-N-(2-phenylethyl)propanamide.
| Compound Name | (3R)-3-(1-benzyl-5-nitroindol-3-yl)-3-phenyl-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 93120140 |
| Molecular Formula | C32H29N3O3 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | (3R)-3-(1-benzyl-5-nitroindol-3-yl)-3-phenyl-N-(2-phenylethyl)propanamide |
| SMILES | O=C(C[C@H](c1ccccc1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12)NCCc1ccccc1 |
| InChI | InChI=1S/C32H29N3O3/c36-32(33-19-18-24-10-4-1-5-11-24)21-28(26-14-8-3-9-15-26)30-23-34(22-25-12-6-2-7-13-25)31-17-16-27(35(37)38)20-29(30)31/h1-17,20,23,28H,18-19,21-22H2,(H,33,36)/t28-/m1/s1 |
| InChIKey | DGZYEMGJDQDCDF-MUUNZHRXSA-N |
| XLogP | 6.48 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|