C31H34N4O4 — CID 93120180
(3S)-3-(1-benzyl-5-nitroindol-3-yl)-N-(3-morpholin-4-ylpropyl)-3-phenylpropanamide (PubChem CID 93120180) has the molecular formula C31H34N4O4 and a molecular weight of 526.64 g/mol. Its IUPAC name is (3S)-3-(1-benzyl-5-nitroindol-3-yl)-N-(3-morpholin-4-ylpropyl)-3-phenylpropanamide.
| Compound Name | (3S)-3-(1-benzyl-5-nitroindol-3-yl)-N-(3-morpholin-4-ylpropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 93120180 |
| Molecular Formula | C31H34N4O4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | (3S)-3-(1-benzyl-5-nitroindol-3-yl)-N-(3-morpholin-4-ylpropyl)-3-phenylpropanamide |
| SMILES | O=C(C[C@@H](c1ccccc1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12)NCCCN1CCOCC1 |
| InChI | InChI=1S/C31H34N4O4/c36-31(32-14-7-15-33-16-18-39-19-17-33)21-27(25-10-5-2-6-11-25)29-23-34(22-24-8-3-1-4-9-24)30-13-12-26(35(37)38)20-28(29)30/h1-6,8-13,20,23,27H,7,14-19,21-22H2,(H,32,36)/t27-/m0/s1 |
| InChIKey | CNJVQRCSZOVVBQ-MHZLTWQESA-N |
| XLogP | 4.96 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|