C27H26FN3O3 — CID 93120205
(3R)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-propylpropanamide (PubChem CID 93120205) has the molecular formula C27H26FN3O3 and a molecular weight of 459.52 g/mol. Its IUPAC name is (3R)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-propylpropanamide.
| Compound Name | (3R)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-propylpropanamide |
|---|---|
| PubChem CID | 93120205 |
| Molecular Formula | C27H26FN3O3 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (3R)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-propylpropanamide |
| SMILES | CCCNC(=O)C[C@H](c1ccc(F)cc1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C27H26FN3O3/c1-2-14-29-27(32)16-23(20-8-10-21(28)11-9-20)25-18-30(17-19-6-4-3-5-7-19)26-13-12-22(31(33)34)15-24(25)26/h3-13,15,18,23H,2,14,16-17H2,1H3,(H,29,32)/t23-/m1/s1 |
| InChIKey | OHALPKGVUAVDDO-HSZRJFAPSA-N |
| XLogP | 5.79 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|