C34H33N3O3 — CID 93120158
(3S)-3-(1-benzyl-5-nitroindol-3-yl)-3-phenyl-N-[(2R)-4-phenylbutan-2-yl]propanamide (PubChem CID 93120158) has the molecular formula C34H33N3O3 and a molecular weight of 531.66 g/mol. Its IUPAC name is (3S)-3-(1-benzyl-5-nitroindol-3-yl)-3-phenyl-N-[(2R)-4-phenylbutan-2-yl]propanamide.
| Compound Name | (3S)-3-(1-benzyl-5-nitroindol-3-yl)-3-phenyl-N-[(2R)-4-phenylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 93120158 |
| Molecular Formula | C34H33N3O3 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | (3S)-3-(1-benzyl-5-nitroindol-3-yl)-3-phenyl-N-[(2R)-4-phenylbutan-2-yl]propanamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)C[C@@H](c1ccccc1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C34H33N3O3/c1-25(17-18-26-11-5-2-6-12-26)35-34(38)22-30(28-15-9-4-10-16-28)32-24-36(23-27-13-7-3-8-14-27)33-20-19-29(37(39)40)21-31(32)33/h2-16,19-21,24-25,30H,17-18,22-23H2,1H3,(H,35,38)/t25-,30+/m1/s1 |
| InChIKey | LCUIMOACHFXQOV-RNAHPLFWSA-N |
| XLogP | 7.26 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|