C32H28FN3O3 — CID 93120202
(3S)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(2-phenylethyl)propanamide (PubChem CID 93120202) has the molecular formula C32H28FN3O3 and a molecular weight of 521.59 g/mol. Its IUPAC name is (3S)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(2-phenylethyl)propanamide.
| Compound Name | (3S)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 93120202 |
| Molecular Formula | C32H28FN3O3 |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | (3S)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(2-phenylethyl)propanamide |
| SMILES | O=C(C[C@@H](c1ccc(F)cc1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12)NCCc1ccccc1 |
| InChI | InChI=1S/C32H28FN3O3/c33-26-13-11-25(12-14-26)28(20-32(37)34-18-17-23-7-3-1-4-8-23)30-22-35(21-24-9-5-2-6-10-24)31-16-15-27(36(38)39)19-29(30)31/h1-16,19,22,28H,17-18,20-21H2,(H,34,37)/t28-/m0/s1 |
| InChIKey | URHHUDTZBRYZHW-NDEPHWFRSA-N |
| XLogP | 6.62 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|