C30H31FN4O3 — CID 93120210
(3S)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(2-pyrrolidin-1-ylethyl)propanamide (PubChem CID 93120210) has the molecular formula C30H31FN4O3 and a molecular weight of 514.60 g/mol. Its IUPAC name is (3S)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(2-pyrrolidin-1-ylethyl)propanamide.
| Compound Name | (3S)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(2-pyrrolidin-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 93120210 |
| Molecular Formula | C30H31FN4O3 |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (3S)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(2-pyrrolidin-1-ylethyl)propanamide |
| SMILES | O=C(C[C@@H](c1ccc(F)cc1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12)NCCN1CCCC1 |
| InChI | InChI=1S/C30H31FN4O3/c31-24-10-8-23(9-11-24)26(19-30(36)32-14-17-33-15-4-5-16-33)28-21-34(20-22-6-2-1-3-7-22)29-13-12-25(35(37)38)18-27(28)29/h1-3,6-13,18,21,26H,4-5,14-17,19-20H2,(H,32,36)/t26-/m0/s1 |
| InChIKey | NZOFNYLWVYTALK-SANMLTNESA-N |
| XLogP | 5.47 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|