C23H25FN4O3 — CID 91635094
3-(4-fluorophenyl)-3-(5-nitro-1H-indol-3-yl)-N-(2-pyrrolidin-1-ylethyl)propanamide (PubChem CID 91635094) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-(5-nitro-1H-indol-3-yl)-N-(2-pyrrolidin-1-ylethyl)propanamide.
| Compound Name | 3-(4-fluorophenyl)-3-(5-nitro-1H-indol-3-yl)-N-(2-pyrrolidin-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 91635094 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-(4-fluorophenyl)-3-(5-nitro-1H-indol-3-yl)-N-(2-pyrrolidin-1-ylethyl)propanamide |
| SMILES | O=C(CC(c1ccc(F)cc1)c1c[nH]c2ccc([N+](=O)[O-])cc12)NCCN1CCCC1 |
| InChI | InChI=1S/C23H25FN4O3/c24-17-5-3-16(4-6-17)19(14-23(29)25-9-12-27-10-1-2-11-27)21-15-26-22-8-7-18(28(30)31)13-20(21)22/h3-8,13,15,19,26H,1-2,9-12,14H2,(H,25,29) |
| InChIKey | NJJMKHZALZKHEY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|