C24H22N4O3 — CID 83290129
3-(1H-indol-3-yl)-3-(4-nitrophenyl)-N-(2-pyridin-2-ylethyl)propanamide (PubChem CID 83290129) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-3-(4-nitrophenyl)-N-(2-pyridin-2-ylethyl)propanamide.
| Compound Name | 3-(1H-indol-3-yl)-3-(4-nitrophenyl)-N-(2-pyridin-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 83290129 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3-(1H-indol-3-yl)-3-(4-nitrophenyl)-N-(2-pyridin-2-ylethyl)propanamide |
| SMILES | O=C(CC(c1ccc([N+](=O)[O-])cc1)c1c[nH]c2ccccc12)NCCc1ccccn1 |
| InChI | InChI=1S/C24H22N4O3/c29-24(26-14-12-18-5-3-4-13-25-18)15-21(17-8-10-19(11-9-17)28(30)31)22-16-27-23-7-2-1-6-20(22)23/h1-11,13,16,21,27H,12,14-15H2,(H,26,29) |
| InChIKey | NRCKGVOGOWEHIH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|