C32H30N4O5 — CID 98443946
(3S)-3-(3-methoxy-4-phenylmethoxyphenyl)-3-(5-nitro-1H-indol-3-yl)-N-(2-pyridin-2-ylethyl)propanamide (PubChem CID 98443946) has the molecular formula C32H30N4O5 and a molecular weight of 550.62 g/mol. Its IUPAC name is (3S)-3-(3-methoxy-4-phenylmethoxyphenyl)-3-(5-nitro-1H-indol-3-yl)-N-(2-pyridin-2-ylethyl)propanamide.
| Compound Name | (3S)-3-(3-methoxy-4-phenylmethoxyphenyl)-3-(5-nitro-1H-indol-3-yl)-N-(2-pyridin-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 98443946 |
| Molecular Formula | C32H30N4O5 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | (3S)-3-(3-methoxy-4-phenylmethoxyphenyl)-3-(5-nitro-1H-indol-3-yl)-N-(2-pyridin-2-ylethyl)propanamide |
| SMILES | COc1cc([C@H](CC(=O)NCCc2ccccn2)c2c[nH]c3ccc([N+](=O)[O-])cc23)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H30N4O5/c1-40-31-17-23(10-13-30(31)41-21-22-7-3-2-4-8-22)26(19-32(37)34-16-14-24-9-5-6-15-33-24)28-20-35-29-12-11-25(36(38)39)18-27(28)29/h2-13,15,17-18,20,26,35H,14,16,19,21H2,1H3,(H,34,37)/t26-/m0/s1 |
| InChIKey | YZTQEJQQJRRCFF-SANMLTNESA-N |
| XLogP | 5.94 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|