C29H32N2O4 — CID 83284865
N-(2-methoxyethyl)-3-(3-methoxy-4-phenylmethoxyphenyl)-3-(1-methylindol-3-yl)propanamide (PubChem CID 83284865) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(3-methoxy-4-phenylmethoxyphenyl)-3-(1-methylindol-3-yl)propanamide.
| Compound Name | N-(2-methoxyethyl)-3-(3-methoxy-4-phenylmethoxyphenyl)-3-(1-methylindol-3-yl)propanamide |
|---|---|
| PubChem CID | 83284865 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | N-(2-methoxyethyl)-3-(3-methoxy-4-phenylmethoxyphenyl)-3-(1-methylindol-3-yl)propanamide |
| SMILES | COCCNC(=O)CC(c1ccc(OCc2ccccc2)c(OC)c1)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C29H32N2O4/c1-31-19-25(23-11-7-8-12-26(23)31)24(18-29(32)30-15-16-33-2)22-13-14-27(28(17-22)34-3)35-20-21-9-5-4-6-10-21/h4-14,17,19,24H,15-16,18,20H2,1-3H3,(H,30,32) |
| InChIKey | YNVPQIOSOBFJFK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|