C30H32N2O3 — CID 83285649
3-(3-methoxy-4-phenylmethoxyphenyl)-3-(1-methylindol-3-yl)-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 83285649) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-(3-methoxy-4-phenylmethoxyphenyl)-3-(1-methylindol-3-yl)-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 3-(3-methoxy-4-phenylmethoxyphenyl)-3-(1-methylindol-3-yl)-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 83285649 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 3-(3-methoxy-4-phenylmethoxyphenyl)-3-(1-methylindol-3-yl)-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | COc1cc(C(CC(=O)N2CCCC2)c2cn(C)c3ccccc23)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H32N2O3/c1-31-20-26(24-12-6-7-13-27(24)31)25(19-30(33)32-16-8-9-17-32)23-14-15-28(29(18-23)34-2)35-21-22-10-4-3-5-11-22/h3-7,10-15,18,20,25H,8-9,16-17,19,21H2,1-2H3 |
| InChIKey | JAQHTSDNOGLOPE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |