C36H38N2O5 — CID 98443934
(3R)-N-(2-methoxyethyl)-3-(4-methoxy-3-phenylmethoxyphenyl)-3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]propanamide (PubChem CID 98443934) has the molecular formula C36H38N2O5 and a molecular weight of 578.71 g/mol. Its IUPAC name is (3R)-N-(2-methoxyethyl)-3-(4-methoxy-3-phenylmethoxyphenyl)-3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]propanamide.
| Compound Name | (3R)-N-(2-methoxyethyl)-3-(4-methoxy-3-phenylmethoxyphenyl)-3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]propanamide |
|---|---|
| PubChem CID | 98443934 |
| Molecular Formula | C36H38N2O5 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | (3R)-N-(2-methoxyethyl)-3-(4-methoxy-3-phenylmethoxyphenyl)-3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]propanamide |
| SMILES | COCCNC(=O)C[C@H](c1ccc(OC)c(OCc2ccccc2)c1)c1cn(Cc2ccc(OC)cc2)c2ccccc12 |
| InChI | InChI=1S/C36H38N2O5/c1-40-20-19-37-36(39)22-31(28-15-18-34(42-3)35(21-28)43-25-27-9-5-4-6-10-27)32-24-38(33-12-8-7-11-30(32)33)23-26-13-16-29(41-2)17-14-26/h4-18,21,24,31H,19-20,22-23,25H2,1-3H3,(H,37,39)/t31-/m1/s1 |
| InChIKey | UDOGXXSDSNSFKZ-WJOKGBTCSA-N |
| XLogP | 6.57 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|