C27H29N3O — CID 5059153
3-(7-ethyl-1H-indol-3-yl)-3-(3-methylphenyl)-N-(2-pyridin-2-ylethyl)propanamide (PubChem CID 5059153) has the molecular formula C27H29N3O and a molecular weight of 411.55 g/mol. Its IUPAC name is 3-(7-ethyl-1H-indol-3-yl)-3-(3-methylphenyl)-N-(2-pyridin-2-ylethyl)propanamide.
| Compound Name | 3-(7-ethyl-1H-indol-3-yl)-3-(3-methylphenyl)-N-(2-pyridin-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 5059153 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 3-(7-ethyl-1H-indol-3-yl)-3-(3-methylphenyl)-N-(2-pyridin-2-ylethyl)propanamide |
| SMILES | CCc1cccc2c(C(CC(=O)NCCc3ccccn3)c3cccc(C)c3)c[nH]c12 |
| InChI | InChI=1S/C27H29N3O/c1-3-20-9-7-12-23-25(18-30-27(20)23)24(21-10-6-8-19(2)16-21)17-26(31)29-15-13-22-11-4-5-14-28-22/h4-12,14,16,18,24,30H,3,13,15,17H2,1-2H3,(H,29,31) |
| InChIKey | DXTLMYTZORMOKQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |