C23H27N3O3 — CID 93123729
(3S)-N-butyl-3-(7-ethyl-1H-indol-3-yl)-3-(3-nitrophenyl)propanamide (PubChem CID 93123729) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is (3S)-N-butyl-3-(7-ethyl-1H-indol-3-yl)-3-(3-nitrophenyl)propanamide.
| Compound Name | (3S)-N-butyl-3-(7-ethyl-1H-indol-3-yl)-3-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 93123729 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (3S)-N-butyl-3-(7-ethyl-1H-indol-3-yl)-3-(3-nitrophenyl)propanamide |
| SMILES | CCCCNC(=O)C[C@@H](c1cccc([N+](=O)[O-])c1)c1c[nH]c2c(CC)cccc12 |
| InChI | InChI=1S/C23H27N3O3/c1-3-5-12-24-22(27)14-20(17-9-6-10-18(13-17)26(28)29)21-15-25-23-16(4-2)8-7-11-19(21)23/h6-11,13,15,20,25H,3-5,12,14H2,1-2H3,(H,24,27)/t20-/m0/s1 |
| InChIKey | YXWFHDVIGOPGLM-FQEVSTJZSA-N |
| XLogP | 5.08 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|