C27H36N2O3 — CID 93125167
(3R)-3-(2,4-dimethoxyphenyl)-3-(7-ethyl-1H-indol-3-yl)-N-hexylpropanamide (PubChem CID 93125167) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is (3R)-3-(2,4-dimethoxyphenyl)-3-(7-ethyl-1H-indol-3-yl)-N-hexylpropanamide.
| Compound Name | (3R)-3-(2,4-dimethoxyphenyl)-3-(7-ethyl-1H-indol-3-yl)-N-hexylpropanamide |
|---|---|
| PubChem CID | 93125167 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | (3R)-3-(2,4-dimethoxyphenyl)-3-(7-ethyl-1H-indol-3-yl)-N-hexylpropanamide |
| SMILES | CCCCCCNC(=O)C[C@@H](c1ccc(OC)cc1OC)c1c[nH]c2c(CC)cccc12 |
| InChI | InChI=1S/C27H36N2O3/c1-5-7-8-9-15-28-26(30)17-23(21-14-13-20(31-3)16-25(21)32-4)24-18-29-27-19(6-2)11-10-12-22(24)27/h10-14,16,18,23,29H,5-9,15,17H2,1-4H3,(H,28,30)/t23-/m0/s1 |
| InChIKey | NNIUBKPCQOCUAE-QHCPKHFHSA-N |
| XLogP | 5.97 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|