C26H33N3O3 — CID 46132436
3-(2,4-dimethoxyphenyl)-3-(1H-indol-3-yl)-N-(2-piperidin-1-ylethyl)propanamide (PubChem CID 46132436) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-3-(1H-indol-3-yl)-N-(2-piperidin-1-ylethyl)propanamide.
| Compound Name | 3-(2,4-dimethoxyphenyl)-3-(1H-indol-3-yl)-N-(2-piperidin-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 46132436 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-3-(1H-indol-3-yl)-N-(2-piperidin-1-ylethyl)propanamide |
| SMILES | COc1ccc(C(CC(=O)NCCN2CCCCC2)c2c[nH]c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C26H33N3O3/c1-31-19-10-11-21(25(16-19)32-2)22(23-18-28-24-9-5-4-8-20(23)24)17-26(30)27-12-15-29-13-6-3-7-14-29/h4-5,8-11,16,18,22,28H,3,6-7,12-15,17H2,1-2H3,(H,27,30) |
| InChIKey | APTNFXXYCOTNSR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |