C25H31ClN2O — CID 42802283
3-(4-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-hexylpropanamide (PubChem CID 42802283) has the molecular formula C25H31ClN2O and a molecular weight of 410.99 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-hexylpropanamide.
| Compound Name | 3-(4-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-hexylpropanamide |
|---|---|
| PubChem CID | 42802283 |
| Molecular Formula | C25H31ClN2O |
| Molecular Weight | 410.99 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-hexylpropanamide |
| SMILES | CCCCCCNC(=O)CC(c1ccc(Cl)cc1)c1c[nH]c2c(CC)cccc12 |
| InChI | InChI=1S/C25H31ClN2O/c1-3-5-6-7-15-27-24(29)16-22(19-11-13-20(26)14-12-19)23-17-28-25-18(4-2)9-8-10-21(23)25/h8-14,17,22,28H,3-7,15-16H2,1-2H3,(H,27,29) |
| InChIKey | QDFDBDPPNFYPNI-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.99 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|