C22H25ClN2O2 — CID 42808770
3-(4-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-(2-methoxyethyl)propanamide (PubChem CID 42808770) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-(4-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 42808770 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-(2-methoxyethyl)propanamide |
| SMILES | CCc1cccc2c(C(CC(=O)NCCOC)c3ccc(Cl)cc3)c[nH]c12 |
| InChI | InChI=1S/C22H25ClN2O2/c1-3-15-5-4-6-18-20(14-25-22(15)18)19(13-21(26)24-11-12-27-2)16-7-9-17(23)10-8-16/h4-10,14,19,25H,3,11-13H2,1-2H3,(H,24,26) |
| InChIKey | KQQKWLKVMJCRIZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|