C23H27ClN2O2 — CID 42803855
3-(2-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-(3-methoxypropyl)propanamide (PubChem CID 42803855) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-(3-methoxypropyl)propanamide.
| Compound Name | 3-(2-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 42803855 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 3-(2-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-(3-methoxypropyl)propanamide |
| SMILES | CCc1cccc2c(C(CC(=O)NCCCOC)c3ccccc3Cl)c[nH]c12 |
| InChI | InChI=1S/C23H27ClN2O2/c1-3-16-8-6-10-18-20(15-26-23(16)18)19(17-9-4-5-11-21(17)24)14-22(27)25-12-7-13-28-2/h4-6,8-11,15,19,26H,3,7,12-14H2,1-2H3,(H,25,27) |
| InChIKey | HJSJPRGFJXGKJN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|