C27H27ClN2O — CID 93123806
(3S)-3-(2-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-[(1S)-1-phenylethyl]propanamide (PubChem CID 93123806) has the molecular formula C27H27ClN2O and a molecular weight of 430.98 g/mol. Its IUPAC name is (3S)-3-(2-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-[(1S)-1-phenylethyl]propanamide.
| Compound Name | (3S)-3-(2-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-[(1S)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 93123806 |
| Molecular Formula | C27H27ClN2O |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (3S)-3-(2-chlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-[(1S)-1-phenylethyl]propanamide |
| SMILES | CCc1cccc2c([C@H](CC(=O)N[C@@H](C)c3ccccc3)c3ccccc3Cl)c[nH]c12 |
| InChI | InChI=1S/C27H27ClN2O/c1-3-19-12-9-14-22-24(17-29-27(19)22)23(21-13-7-8-15-25(21)28)16-26(31)30-18(2)20-10-5-4-6-11-20/h4-15,17-18,23,29H,3,16H2,1-2H3,(H,30,31)/t18-,23+/m0/s1 |
| InChIKey | YTVROIPBIZOXQL-FDDCHVKYSA-N |
| XLogP | 6.78 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |