C29H31FN2O — CID 42802343
3-(7-ethyl-1H-indol-3-yl)-3-(3-fluorophenyl)-N-(4-phenylbutan-2-yl)propanamide (PubChem CID 42802343) has the molecular formula C29H31FN2O and a molecular weight of 442.58 g/mol. Its IUPAC name is 3-(7-ethyl-1H-indol-3-yl)-3-(3-fluorophenyl)-N-(4-phenylbutan-2-yl)propanamide.
| Compound Name | 3-(7-ethyl-1H-indol-3-yl)-3-(3-fluorophenyl)-N-(4-phenylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 42802343 |
| Molecular Formula | C29H31FN2O |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 3-(7-ethyl-1H-indol-3-yl)-3-(3-fluorophenyl)-N-(4-phenylbutan-2-yl)propanamide |
| SMILES | CCc1cccc2c(C(CC(=O)NC(C)CCc3ccccc3)c3cccc(F)c3)c[nH]c12 |
| InChI | InChI=1S/C29H31FN2O/c1-3-22-11-8-14-25-27(19-31-29(22)25)26(23-12-7-13-24(30)17-23)18-28(33)32-20(2)15-16-21-9-5-4-6-10-21/h4-14,17,19-20,26,31H,3,15-16,18H2,1-2H3,(H,32,33) |
| InChIKey | RWHBIMZKGLCMPS-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |