C25H29FN2O — CID 42666875
3-(7-ethyl-1H-indol-3-yl)-3-(3-fluorophenyl)-1-(4-methylpiperidin-1-yl)propan-1-one (PubChem CID 42666875) has the molecular formula C25H29FN2O and a molecular weight of 392.52 g/mol. Its IUPAC name is 3-(7-ethyl-1H-indol-3-yl)-3-(3-fluorophenyl)-1-(4-methylpiperidin-1-yl)propan-1-one.
| Compound Name | 3-(7-ethyl-1H-indol-3-yl)-3-(3-fluorophenyl)-1-(4-methylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 42666875 |
| Molecular Formula | C25H29FN2O |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 3-(7-ethyl-1H-indol-3-yl)-3-(3-fluorophenyl)-1-(4-methylpiperidin-1-yl)propan-1-one |
| SMILES | CCc1cccc2c(C(CC(=O)N3CCC(C)CC3)c3cccc(F)c3)c[nH]c12 |
| InChI | InChI=1S/C25H29FN2O/c1-3-18-6-5-9-21-23(16-27-25(18)21)22(19-7-4-8-20(26)14-19)15-24(29)28-12-10-17(2)11-13-28/h4-9,14,16-17,22,27H,3,10-13,15H2,1-2H3 |
| InChIKey | GTUMSZUIPSOIDJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |