C30H32FN3O2 — CID 93122356
(3R)-3-(7-ethyl-1H-indol-3-yl)-3-(3-fluorophenyl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one (PubChem CID 93122356) has the molecular formula C30H32FN3O2 and a molecular weight of 485.60 g/mol. Its IUPAC name is (3R)-3-(7-ethyl-1H-indol-3-yl)-3-(3-fluorophenyl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one.
| Compound Name | (3R)-3-(7-ethyl-1H-indol-3-yl)-3-(3-fluorophenyl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 93122356 |
| Molecular Formula | C30H32FN3O2 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (3R)-3-(7-ethyl-1H-indol-3-yl)-3-(3-fluorophenyl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one |
| SMILES | CCc1cccc2c([C@H](CC(=O)N3CCN(c4ccc(OC)cc4)CC3)c3cccc(F)c3)c[nH]c12 |
| InChI | InChI=1S/C30H32FN3O2/c1-3-21-6-5-9-26-28(20-32-30(21)26)27(22-7-4-8-23(31)18-22)19-29(35)34-16-14-33(15-17-34)24-10-12-25(36-2)13-11-24/h4-13,18,20,27,32H,3,14-17,19H2,1-2H3/t27-/m1/s1 |
| InChIKey | QGVSPDMWQOZVAG-HHHXNRCGSA-N |
| XLogP | 5.75 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|