C33H32N2O2 — CID 42802298
N-benzhydryl-3-(7-ethyl-1H-indol-3-yl)-3-(4-methoxyphenyl)propanamide (PubChem CID 42802298) has the molecular formula C33H32N2O2 and a molecular weight of 488.63 g/mol. Its IUPAC name is N-benzhydryl-3-(7-ethyl-1H-indol-3-yl)-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-benzhydryl-3-(7-ethyl-1H-indol-3-yl)-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 42802298 |
| Molecular Formula | C33H32N2O2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | N-benzhydryl-3-(7-ethyl-1H-indol-3-yl)-3-(4-methoxyphenyl)propanamide |
| SMILES | CCc1cccc2c(C(CC(=O)NC(c3ccccc3)c3ccccc3)c3ccc(OC)cc3)c[nH]c12 |
| InChI | InChI=1S/C33H32N2O2/c1-3-23-15-10-16-28-30(22-34-33(23)28)29(24-17-19-27(37-2)20-18-24)21-31(36)35-32(25-11-6-4-7-12-25)26-13-8-5-9-14-26/h4-20,22,29,32,34H,3,21H2,1-2H3,(H,35,36) |
| InChIKey | JHZDIIWDGXZALX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |