C34H34N2O3 — CID 42804555
N-benzhydryl-3-(2,4-dimethoxyphenyl)-3-(7-ethyl-1H-indol-3-yl)propanamide (PubChem CID 42804555) has the molecular formula C34H34N2O3 and a molecular weight of 518.66 g/mol. Its IUPAC name is N-benzhydryl-3-(2,4-dimethoxyphenyl)-3-(7-ethyl-1H-indol-3-yl)propanamide.
| Compound Name | N-benzhydryl-3-(2,4-dimethoxyphenyl)-3-(7-ethyl-1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 42804555 |
| Molecular Formula | C34H34N2O3 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | N-benzhydryl-3-(2,4-dimethoxyphenyl)-3-(7-ethyl-1H-indol-3-yl)propanamide |
| SMILES | CCc1cccc2c(C(CC(=O)NC(c3ccccc3)c3ccccc3)c3ccc(OC)cc3OC)c[nH]c12 |
| InChI | InChI=1S/C34H34N2O3/c1-4-23-16-11-17-28-30(22-35-34(23)28)29(27-19-18-26(38-2)20-31(27)39-3)21-32(37)36-33(24-12-7-5-8-13-24)25-14-9-6-10-15-25/h5-20,22,29,33,35H,4,21H2,1-3H3,(H,36,37) |
| InChIKey | OJMNZERSQGBIIJ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |