C27H28N2O3 — CID 42778032
N-ethoxy-3-(7-ethyl-1H-indol-3-yl)-3-(3-phenoxyphenyl)propanamide (PubChem CID 42778032) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-ethoxy-3-(7-ethyl-1H-indol-3-yl)-3-(3-phenoxyphenyl)propanamide.
| Compound Name | N-ethoxy-3-(7-ethyl-1H-indol-3-yl)-3-(3-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 42778032 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-ethoxy-3-(7-ethyl-1H-indol-3-yl)-3-(3-phenoxyphenyl)propanamide |
| SMILES | CCONC(=O)CC(c1cccc(Oc2ccccc2)c1)c1c[nH]c2c(CC)cccc12 |
| InChI | InChI=1S/C27H28N2O3/c1-3-19-10-9-15-23-25(18-28-27(19)23)24(17-26(30)29-31-4-2)20-11-8-14-22(16-20)32-21-12-6-5-7-13-21/h5-16,18,24,28H,3-4,17H2,1-2H3,(H,29,30) |
| InChIKey | QPGKQWPQALVMAT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|