C30H28N2O3 — CID 4006072
3-(7-ethyl-1H-indol-3-yl)-N-(furan-2-ylmethyl)-3-(3-phenoxyphenyl)propanamide (PubChem CID 4006072) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 3-(7-ethyl-1H-indol-3-yl)-N-(furan-2-ylmethyl)-3-(3-phenoxyphenyl)propanamide.
| Compound Name | 3-(7-ethyl-1H-indol-3-yl)-N-(furan-2-ylmethyl)-3-(3-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 4006072 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 3-(7-ethyl-1H-indol-3-yl)-N-(furan-2-ylmethyl)-3-(3-phenoxyphenyl)propanamide |
| SMILES | CCc1cccc2c(C(CC(=O)NCc3ccco3)c3cccc(Oc4ccccc4)c3)c[nH]c12 |
| InChI | InChI=1S/C30H28N2O3/c1-2-21-9-7-15-26-28(20-32-30(21)26)27(18-29(33)31-19-25-14-8-16-34-25)22-10-6-13-24(17-22)35-23-11-4-3-5-12-23/h3-17,20,27,32H,2,18-19H2,1H3,(H,31,33) |
| InChIKey | KJPICVVTQXIMNP-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |