C26H25NO3 — CID 42774239
3-(7-ethyl-1H-indol-3-yl)-3-(3-phenylmethoxyphenyl)propanoic acid (PubChem CID 42774239) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is 3-(7-ethyl-1H-indol-3-yl)-3-(3-phenylmethoxyphenyl)propanoic acid.
| Compound Name | 3-(7-ethyl-1H-indol-3-yl)-3-(3-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 42774239 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 3-(7-ethyl-1H-indol-3-yl)-3-(3-phenylmethoxyphenyl)propanoic acid |
| SMILES | CCc1cccc2c(C(CC(=O)O)c3cccc(OCc4ccccc4)c3)c[nH]c12 |
| InChI | InChI=1S/C26H25NO3/c1-2-19-10-7-13-22-24(16-27-26(19)22)23(15-25(28)29)20-11-6-12-21(14-20)30-17-18-8-4-3-5-9-18/h3-14,16,23,27H,2,15,17H2,1H3,(H,28,29) |
| InChIKey | OUDPZORPFLGMCG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |