C32H30N2O2 — CID 3548226
N-(3,4-dimethylphenyl)-3-(1H-indol-3-yl)-3-(3-phenylmethoxyphenyl)propanamide (PubChem CID 3548226) has the molecular formula C32H30N2O2 and a molecular weight of 474.60 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3-(1H-indol-3-yl)-3-(3-phenylmethoxyphenyl)propanamide.
| Compound Name | N-(3,4-dimethylphenyl)-3-(1H-indol-3-yl)-3-(3-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 3548226 |
| Molecular Formula | C32H30N2O2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3-(1H-indol-3-yl)-3-(3-phenylmethoxyphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CC(c2cccc(OCc3ccccc3)c2)c2c[nH]c3ccccc23)cc1C |
| InChI | InChI=1S/C32H30N2O2/c1-22-15-16-26(17-23(22)2)34-32(35)19-29(30-20-33-31-14-7-6-13-28(30)31)25-11-8-12-27(18-25)36-21-24-9-4-3-5-10-24/h3-18,20,29,33H,19,21H2,1-2H3,(H,34,35) |
| InChIKey | OLRLARXRFPYSJX-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |