C27H26Cl2N2O — CID 24718694
3-(3,4-dichlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-(2-phenylethyl)propanamide (PubChem CID 24718694) has the molecular formula C27H26Cl2N2O and a molecular weight of 465.42 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-(2-phenylethyl)propanamide.
| Compound Name | 3-(3,4-dichlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 24718694 |
| Molecular Formula | C27H26Cl2N2O |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-3-(7-ethyl-1H-indol-3-yl)-N-(2-phenylethyl)propanamide |
| SMILES | CCc1cccc2c(C(CC(=O)NCCc3ccccc3)c3ccc(Cl)c(Cl)c3)c[nH]c12 |
| InChI | InChI=1S/C27H26Cl2N2O/c1-2-19-9-6-10-21-23(17-31-27(19)21)22(20-11-12-24(28)25(29)15-20)16-26(32)30-14-13-18-7-4-3-5-8-18/h3-12,15,17,22,31H,2,13-14,16H2,1H3,(H,30,32) |
| InChIKey | HVZSALADYUILPR-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |