C30H31FN4O4 — CID 93120215
(3R)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(2-morpholin-4-ylethyl)propanamide (PubChem CID 93120215) has the molecular formula C30H31FN4O4 and a molecular weight of 530.60 g/mol. Its IUPAC name is (3R)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(2-morpholin-4-ylethyl)propanamide.
| Compound Name | (3R)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(2-morpholin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 93120215 |
| Molecular Formula | C30H31FN4O4 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | (3R)-3-(1-benzyl-5-nitroindol-3-yl)-3-(4-fluorophenyl)-N-(2-morpholin-4-ylethyl)propanamide |
| SMILES | O=C(C[C@H](c1ccc(F)cc1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12)NCCN1CCOCC1 |
| InChI | InChI=1S/C30H31FN4O4/c31-24-8-6-23(7-9-24)26(19-30(36)32-12-13-33-14-16-39-17-15-33)28-21-34(20-22-4-2-1-3-5-22)29-11-10-25(35(37)38)18-27(28)29/h1-11,18,21,26H,12-17,19-20H2,(H,32,36)/t26-/m1/s1 |
| InChIKey | RRUQCGXKHYBFJY-AREMUKBSSA-N |
| XLogP | 4.71 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|