C29H30FN3O3 — CID 42801425
3-(1-benzyl-5-nitroindol-3-yl)-3-(3-fluorophenyl)-N-(3-methylbutyl)propanamide (PubChem CID 42801425) has the molecular formula C29H30FN3O3 and a molecular weight of 487.58 g/mol. Its IUPAC name is 3-(1-benzyl-5-nitroindol-3-yl)-3-(3-fluorophenyl)-N-(3-methylbutyl)propanamide.
| Compound Name | 3-(1-benzyl-5-nitroindol-3-yl)-3-(3-fluorophenyl)-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 42801425 |
| Molecular Formula | C29H30FN3O3 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 3-(1-benzyl-5-nitroindol-3-yl)-3-(3-fluorophenyl)-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)CC(c1cccc(F)c1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C29H30FN3O3/c1-20(2)13-14-31-29(34)17-25(22-9-6-10-23(30)15-22)27-19-32(18-21-7-4-3-5-8-21)28-12-11-24(33(35)36)16-26(27)28/h3-12,15-16,19-20,25H,13-14,17-18H2,1-2H3,(H,31,34) |
| InChIKey | JGPJFAUKUUAQOS-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|