C34H31N5O5 — CID 42801412
3-(1-benzyl-5-nitroindol-3-yl)-1-[4-(4-nitrophenyl)piperazin-1-yl]-3-phenylpropan-1-one (PubChem CID 42801412) has the molecular formula C34H31N5O5 and a molecular weight of 589.65 g/mol. Its IUPAC name is 3-(1-benzyl-5-nitroindol-3-yl)-1-[4-(4-nitrophenyl)piperazin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 3-(1-benzyl-5-nitroindol-3-yl)-1-[4-(4-nitrophenyl)piperazin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 42801412 |
| Molecular Formula | C34H31N5O5 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 3-(1-benzyl-5-nitroindol-3-yl)-1-[4-(4-nitrophenyl)piperazin-1-yl]-3-phenylpropan-1-one |
| SMILES | O=C(CC(c1ccccc1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C34H31N5O5/c40-34(36-19-17-35(18-20-36)27-11-13-28(14-12-27)38(41)42)22-30(26-9-5-2-6-10-26)32-24-37(23-25-7-3-1-4-8-25)33-16-15-29(39(43)44)21-31(32)33/h1-16,21,24,30H,17-20,22-23H2 |
| InChIKey | KMUJXZWIJDFDFV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 114.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|