C34H31ClN4O3 — CID 98425724
(3R)-3-(1-benzyl-5-nitroindol-3-yl)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-phenylpropan-1-one (PubChem CID 98425724) has the molecular formula C34H31ClN4O3 and a molecular weight of 579.10 g/mol. Its IUPAC name is (3R)-3-(1-benzyl-5-nitroindol-3-yl)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-phenylpropan-1-one.
| Compound Name | (3R)-3-(1-benzyl-5-nitroindol-3-yl)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 98425724 |
| Molecular Formula | C34H31ClN4O3 |
| Molecular Weight | 579.10 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | (3R)-3-(1-benzyl-5-nitroindol-3-yl)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-phenylpropan-1-one |
| SMILES | O=C(C[C@H](c1ccccc1)c1cn(Cc2ccccc2)c2ccc([N+](=O)[O-])cc12)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C34H31ClN4O3/c35-31-13-7-8-14-33(31)36-17-19-37(20-18-36)34(40)22-28(26-11-5-2-6-12-26)30-24-38(23-25-9-3-1-4-10-25)32-16-15-27(39(41)42)21-29(30)32/h1-16,21,24,28H,17-20,22-23H2/t28-/m1/s1 |
| InChIKey | SJJILJYFTLCOEQ-MUUNZHRXSA-N |
| XLogP | 7.12 |
| TPSA | 71.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.10 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|